C14H21NS2 — CID 117422419
4-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperidine (PubChem CID 117422419) has the molecular formula C14H21NS2 and a molecular weight of 267.46 g/mol. Its IUPAC name is 4-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperidine.
| Compound Name | 4-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117422419 |
| Molecular Formula | C14H21NS2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperidine |
| SMILES | CSc1ccc(CC2CCNCC2)c(SC)c1 |
| InChI | InChI=1S/C14H21NS2/c1-16-13-4-3-12(14(10-13)17-2)9-11-5-7-15-8-6-11/h3-4,10-11,15H,5-9H2,1-2H3 |
| InChIKey | ZVVGOBYMSKIGJM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |