C15H23N — CID 116925401
4-[(2,3,4-trimethylphenyl)methyl]piperidine (PubChem CID 116925401) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-[(2,3,4-trimethylphenyl)methyl]piperidine.
| Compound Name | 4-[(2,3,4-trimethylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 116925401 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-[(2,3,4-trimethylphenyl)methyl]piperidine |
| SMILES | Cc1ccc(CC2CCNCC2)c(C)c1C |
| InChI | InChI=1S/C15H23N/c1-11-4-5-15(13(3)12(11)2)10-14-6-8-16-9-7-14/h4-5,14,16H,6-10H2,1-3H3 |
| InChIKey | LHIMNDNICCHGFW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |