C10H15NOS2 — CID 117331169
O-[2-[2,4-bis(methylsulfanyl)phenyl]ethyl]hydroxylamine (PubChem CID 117331169) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is O-[2-[2,4-bis(methylsulfanyl)phenyl]ethyl]hydroxylamine.
| Compound Name | O-[2-[2,4-bis(methylsulfanyl)phenyl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117331169 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | O-[2-[2,4-bis(methylsulfanyl)phenyl]ethyl]hydroxylamine |
| SMILES | CSc1ccc(CCON)c(SC)c1 |
| InChI | InChI=1S/C10H15NOS2/c1-13-9-4-3-8(5-6-12-11)10(7-9)14-2/h3-4,7H,5-6,11H2,1-2H3 |
| InChIKey | OVLVACVQVUDFGQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|