C11H15NS2 — CID 84790451
1-[2,4-bis(methylsulfanyl)phenyl]cyclopropan-1-amine (PubChem CID 84790451) has the molecular formula C11H15NS2 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfanyl)phenyl]cyclopropan-1-amine.
| Compound Name | 1-[2,4-bis(methylsulfanyl)phenyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 84790451 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-[2,4-bis(methylsulfanyl)phenyl]cyclopropan-1-amine |
| SMILES | CSc1ccc(C2(N)CC2)c(SC)c1 |
| InChI | InChI=1S/C11H15NS2/c1-13-8-3-4-9(10(7-8)14-2)11(12)5-6-11/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | AVFUXFOHCQQWEW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |