C8H10N2OS — CID 55280828
2-hydrazinyl-7-methylsulfanylcyclohepta-2,4,6-trien-1-one (PubChem CID 55280828) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 2-hydrazinyl-7-methylsulfanylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-hydrazinyl-7-methylsulfanylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 55280828 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-hydrazinyl-7-methylsulfanylcyclohepta-2,4,6-trien-1-one |
| SMILES | CSc1ccccc(NN)c1=O |
| InChI | InChI=1S/C8H10N2OS/c1-12-7-5-3-2-4-6(10-9)8(7)11/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | UTZQCKVRPCYBOI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|