C18H23N5O — CID 142338052
2-methanimidoyl-N-propan-2-yl-5-[3-(1-prop-1-en-2-ylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 142338052) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-methanimidoyl-N-propan-2-yl-5-[3-(1-prop-1-en-2-ylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-methanimidoyl-N-propan-2-yl-5-[3-(1-prop-1-en-2-ylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 142338052 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-methanimidoyl-N-propan-2-yl-5-[3-(1-prop-1-en-2-ylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | [H]/N=C/c1ccc(-c2nc(C3CN(C(=C)C)C3)no2)cc1NC(C)C |
| InChI | InChI=1S/C18H23N5O/c1-11(2)20-16-7-13(5-6-14(16)8-19)18-21-17(22-24-18)15-9-23(10-15)12(3)4/h5-8,11,15,19-20H,3,9-10H2,1-2,4H3/b19-8+ |
| InChIKey | SLICJZFEAVALFN-UFWORHAWSA-N |
| XLogP | 3.49 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|