C23H24N6O3 — CID 142573522
[4-[5-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-oxadiazol-3-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 142573522) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is [4-[5-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-oxadiazol-3-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[5-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-oxadiazol-3-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 142573522 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [4-[5-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-oxadiazol-3-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | [H]/N=C/c1ccc(-c2nc(N3CCN(C(=O)c4ccccc4)CC3)no2)cc1NC1COC1 |
| InChI | InChI=1S/C23H24N6O3/c24-13-18-7-6-17(12-20(18)25-19-14-31-15-19)21-26-23(27-32-21)29-10-8-28(9-11-29)22(30)16-4-2-1-3-5-16/h1-7,12-13,19,24-25H,8-11,14-15H2/b24-13+ |
| InChIKey | WVMLGSWDNBGKPF-ZMOGYAJESA-N |
| XLogP | 2.51 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|