C11H14N2O — CID 143701091
N-(2-methanimidoyl-4,5-dimethylphenyl)acetamide (PubChem CID 143701091) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(2-methanimidoyl-4,5-dimethylphenyl)acetamide.
| Compound Name | N-(2-methanimidoyl-4,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 143701091 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-(2-methanimidoyl-4,5-dimethylphenyl)acetamide |
| SMILES | [H]/N=C/c1cc(C)c(C)cc1NC(C)=O |
| InChI | InChI=1S/C11H14N2O/c1-7-4-10(6-12)11(5-8(7)2)13-9(3)14/h4-6,12H,1-3H3,(H,13,14)/b12-6+ |
| InChIKey | ZDYSSTYXJSNSSU-WUXMJOGZSA-N |
| XLogP | 2.26 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|