C17H14Cl2N6OS — CID 145146541
N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-4-chlorophenyl]acetamide (PubChem CID 145146541) has the molecular formula C17H14Cl2N6OS and a molecular weight of 421.31 g/mol. Its IUPAC name is N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-4-chlorophenyl]acetamide.
| Compound Name | N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-4-chlorophenyl]acetamide |
|---|---|
| PubChem CID | 145146541 |
| Molecular Formula | C17H14Cl2N6OS |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-4-chlorophenyl]acetamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nnc(-c3cc(NC(C)=O)ccc3Cl)s2)c1Cl |
| InChI | InChI=1S/C17H14Cl2N6OS/c1-8(26)22-9-2-3-12(18)10(6-9)16-24-25-17(27-16)23-14-5-4-13(21)11(7-20)15(14)19/h2-7,20H,21H2,1H3,(H,22,26)(H,23,25)/b20-7+ |
| InChIKey | UZHVZQAUBIGZJP-IFRROFPPSA-N |
| XLogP | 4.79 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|