C20H22ClN7OS — CID 145146558
N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-5-[(dimethylamino)methyl]phenyl]acetamide (PubChem CID 145146558) has the molecular formula C20H22ClN7OS and a molecular weight of 443.96 g/mol. Its IUPAC name is N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-5-[(dimethylamino)methyl]phenyl]acetamide.
| Compound Name | N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-5-[(dimethylamino)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 145146558 |
| Molecular Formula | C20H22ClN7OS |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[3-[5-(4-amino-2-chloro-3-methanimidoylanilino)-1,3,4-thiadiazol-2-yl]-5-[(dimethylamino)methyl]phenyl]acetamide |
| SMILES | [H]/N=C/c1c(N)ccc(Nc2nnc(-c3cc(CN(C)C)cc(NC(C)=O)c3)s2)c1Cl |
| InChI | InChI=1S/C20H22ClN7OS/c1-11(29)24-14-7-12(10-28(2)3)6-13(8-14)19-26-27-20(30-19)25-17-5-4-16(23)15(9-22)18(17)21/h4-9,22H,10,23H2,1-3H3,(H,24,29)(H,25,27)/b22-9+ |
| InChIKey | QCHMLSCVALQAJY-LSFURLLWSA-N |
| XLogP | 4.20 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|