C25H33F3N6 — CID 176553243
N-[3-(2-cyanopropan-2-ylamino)-2-methanimidoylphenyl]-N'-[(1E,3E)-1-(cyclobutylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide (PubChem CID 176553243) has the molecular formula C25H33F3N6 and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[3-(2-cyanopropan-2-ylamino)-2-methanimidoylphenyl]-N'-[(1E,3E)-1-(cyclobutylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide.
| Compound Name | N-[3-(2-cyanopropan-2-ylamino)-2-methanimidoylphenyl]-N'-[(1E,3E)-1-(cyclobutylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 176553243 |
| Molecular Formula | C25H33F3N6 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-[3-(2-cyanopropan-2-ylamino)-2-methanimidoylphenyl]-N'-[(1E,3E)-1-(cyclobutylamino)-2-(trifluoromethyl)hepta-1,3-dienyl]ethanimidamide |
| SMILES | [H]/N=C/c1c(N/C(C)=N/C(NC2CCC2)=C(\C=C\CCC)C(F)(F)F)cccc1NC(C)(C)C#N |
| InChI | InChI=1S/C25H33F3N6/c1-5-6-7-12-20(25(26,27)28)23(33-18-10-8-11-18)32-17(2)31-21-13-9-14-22(19(21)15-29)34-24(3,4)16-30/h7,9,12-15,18,29,33-34H,5-6,8,10-11H2,1-4H3,(H,31,32)/b12-7+,23-20-,29-15+ |
| InChIKey | WXPSLXXMLGLIEZ-HWSZZPHESA-N |
| XLogP | 6.50 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|