C17H19F3N6 — CID 174318902
4-N-cyclopropyl-2-N-[3-(ethylamino)-2-methanimidoylphenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 174318902) has the molecular formula C17H19F3N6 and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N-[3-(ethylamino)-2-methanimidoylphenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-2-N-[3-(ethylamino)-2-methanimidoylphenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174318902 |
| Molecular Formula | C17H19F3N6 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-N-cyclopropyl-2-N-[3-(ethylamino)-2-methanimidoylphenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | [H]/N=C/c1c(NCC)cccc1Nc1ncc(C(F)(F)F)c(NC2CC2)n1 |
| InChI | InChI=1S/C17H19F3N6/c1-2-22-13-4-3-5-14(11(13)8-21)25-16-23-9-12(17(18,19)20)15(26-16)24-10-6-7-10/h3-5,8-10,21-22H,2,6-7H2,1H3,(H2,23,24,25,26)/b21-8+ |
| InChIKey | JGTWIJREHYDERP-ODCIPOBUSA-N |
| XLogP | 4.24 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|