C18H20F4N7O+ — CID 176553295
2-[3-[[4-(cyclopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-6-fluoro-2-methanimidoylanilino]ethyl-methyl-oxoazanium (PubChem CID 176553295) has the molecular formula C18H20F4N7O+ and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-[3-[[4-(cyclopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-6-fluoro-2-methanimidoylanilino]ethyl-methyl-oxoazanium.
| Compound Name | 2-[3-[[4-(cyclopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-6-fluoro-2-methanimidoylanilino]ethyl-methyl-oxoazanium |
|---|---|
| PubChem CID | 176553295 |
| Molecular Formula | C18H20F4N7O+ |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[3-[[4-(cyclopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-6-fluoro-2-methanimidoylanilino]ethyl-methyl-oxoazanium |
| SMILES | [H]/N=C/c1c(Nc2ncc(C(F)(F)F)c(NC3CC3)n2)ccc(F)c1NCC[N+](C)=O |
| InChI | InChI=1S/C18H20F4N7O/c1-29(30)7-6-24-15-11(8-23)14(5-4-13(15)19)27-17-25-9-12(18(20,21)22)16(28-17)26-10-2-3-10/h4-5,8-10,23-24H,2-3,6-7H2,1H3,(H2,25,26,27,28)/q+1/b23-8+ |
| InChIKey | POHROJFLBILPDI-LIMNOBDPSA-N |
| XLogP | 3.77 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|