C20H21N5O3 — CID 144529952
2-(2-aminophenyl)-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-2-iminoacetamide (PubChem CID 144529952) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-2-iminoacetamide.
| Compound Name | 2-(2-aminophenyl)-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-2-iminoacetamide |
|---|---|
| PubChem CID | 144529952 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(2-aminophenyl)-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-2-iminoacetamide |
| SMILES | [H]/N=C(/C(=O)Nc1cnn(Cc2cc(OC)cc(OC)c2)c1)c1ccccc1N |
| InChI | InChI=1S/C20H21N5O3/c1-27-15-7-13(8-16(9-15)28-2)11-25-12-14(10-23-25)24-20(26)19(22)17-5-3-4-6-18(17)21/h3-10,12,22H,11,21H2,1-2H3,(H,24,26)/b22-19+ |
| InChIKey | SNOTYBARZPSRDU-ZBJSNUHESA-N |
| XLogP | 2.54 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|