C19H23N5O2 — CID 144529888
2-(2-aminophenyl)-2-imino-N-[1-[(2-methoxyphenyl)methyl]pyrazol-4-yl]acetamide;molecular hydrogen (PubChem CID 144529888) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-(2-aminophenyl)-2-imino-N-[1-[(2-methoxyphenyl)methyl]pyrazol-4-yl]acetamide;molecular hydrogen.
| Compound Name | 2-(2-aminophenyl)-2-imino-N-[1-[(2-methoxyphenyl)methyl]pyrazol-4-yl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 144529888 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-(2-aminophenyl)-2-imino-N-[1-[(2-methoxyphenyl)methyl]pyrazol-4-yl]acetamide;molecular hydrogen |
| SMILES | [H]/N=C(\C(=O)Nc1cnn(Cc2ccccc2OC)c1)c1ccccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C19H19N5O2.2H2/c1-26-17-9-5-2-6-13(17)11-24-12-14(10-22-24)23-19(25)18(21)15-7-3-4-8-16(15)20;;/h2-10,12,21H,11,20H2,1H3,(H,23,25);2*1H/b21-18-;; |
| InChIKey | WYPBJJWQOUTSKS-LUUCHEBKSA-N |
| XLogP | 3.02 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|