C18H19F2N5O — CID 144529831
2-(2-aminophenyl)-N-[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]-2-iminoacetamide;molecular hydrogen (PubChem CID 144529831) has the molecular formula C18H19F2N5O and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]-2-iminoacetamide;molecular hydrogen.
| Compound Name | 2-(2-aminophenyl)-N-[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]-2-iminoacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 144529831 |
| Molecular Formula | C18H19F2N5O |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-(2-aminophenyl)-N-[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]-2-iminoacetamide;molecular hydrogen |
| SMILES | [H]/N=C(\C(=O)Nc1cnn(Cc2ccc(F)cc2F)c1)c1ccccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C18H15F2N5O.2H2/c19-12-6-5-11(15(20)7-12)9-25-10-13(8-23-25)24-18(26)17(22)14-3-1-2-4-16(14)21;;/h1-8,10,22H,9,21H2,(H,24,26);2*1H/b22-17-;; |
| InChIKey | KSFUWRNPIAVVBI-BBFBTWSBSA-N |
| XLogP | 3.29 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|