C19H17N3O4 — CID 35521452
2-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]benzoic acid (PubChem CID 35521452) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 35521452 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]benzoic acid |
| SMILES | COc1cccc(Cn2cc(NC(=O)c3ccccc3C(=O)O)cn2)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-26-15-6-4-5-13(9-15)11-22-12-14(10-20-22)21-18(23)16-7-2-3-8-17(16)19(24)25/h2-10,12H,11H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | YHAGOUUPROGFNL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |