C17H17N5O4 — CID 19496247
4-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19496247) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19496247 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[[1-[(3-methoxyphenyl)methyl]pyrazol-4-yl]carbamoyl]-1-methylpyrazole-5-carboxylic acid |
| SMILES | COc1cccc(Cn2cc(NC(=O)c3cnn(C)c3C(=O)O)cn2)c1 |
| InChI | InChI=1S/C17H17N5O4/c1-21-15(17(24)25)14(8-18-21)16(23)20-12-7-19-22(10-12)9-11-4-3-5-13(6-11)26-2/h3-8,10H,9H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | OOXFRVLFTUYOSS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |