C21H19N7 — CID 166551442
4-(pyridine-4-carboximidoyl)-1-N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]benzene-1,3-diamine (PubChem CID 166551442) has the molecular formula C21H19N7 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-(pyridine-4-carboximidoyl)-1-N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 4-(pyridine-4-carboximidoyl)-1-N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 166551442 |
| Molecular Formula | C21H19N7 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-(pyridine-4-carboximidoyl)-1-N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]benzene-1,3-diamine |
| SMILES | [H]/N=C(\c1ccncc1)c1ccc(Nc2cccc(Cn3cncn3)c2)cc1N |
| InChI | InChI=1S/C21H19N7/c22-20-11-18(4-5-19(20)21(23)16-6-8-24-9-7-16)27-17-3-1-2-15(10-17)12-28-14-25-13-26-28/h1-11,13-14,23,27H,12,22H2/b23-21+ |
| InChIKey | CBIODIVSSBMWKU-XTQSDGFTSA-N |
| XLogP | 3.46 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|