C20H16N4O2 — CID 155481992
N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-3-cyano-2-methylbenzamide (PubChem CID 155481992) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-3-cyano-2-methylbenzamide.
| Compound Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-3-cyano-2-methylbenzamide |
|---|---|
| PubChem CID | 155481992 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-3-cyano-2-methylbenzamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)c2cccc(C#N)c2C)ccc1N |
| InChI | InChI=1S/C20H16N4O2/c1-12-13(10-21)3-2-4-16(12)20(25)24-15-5-6-18(22)17(9-15)19(23)14-7-8-26-11-14/h2-9,11,23H,22H2,1H3,(H,24,25)/b23-19+ |
| InChIKey | MYVYJAHDLRBYDY-FCDQGJHFSA-N |
| XLogP | 3.71 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|