C18H14N4O3 — CID 167698553
3-cyano-N-[3-(furan-3-carboximidoyl)-4-methylphenyl]-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 167698553) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-cyano-N-[3-(furan-3-carboximidoyl)-4-methylphenyl]-4-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | 3-cyano-N-[3-(furan-3-carboximidoyl)-4-methylphenyl]-4-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 167698553 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-cyano-N-[3-(furan-3-carboximidoyl)-4-methylphenyl]-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)c2onc(C#N)c2C)ccc1C |
| InChI | InChI=1S/C18H14N4O3/c1-10-3-4-13(7-14(10)16(20)12-5-6-24-9-12)21-18(23)17-11(2)15(8-19)22-25-17/h3-7,9,20H,1-2H3,(H,21,23)/b20-16+ |
| InChIKey | YAGLRIPGMVEOON-CAPFRKAQSA-N |
| XLogP | 3.42 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|