C19H13FN4O2 — CID 155482453
N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-cyano-2-fluorobenzamide (PubChem CID 155482453) has the molecular formula C19H13FN4O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-cyano-2-fluorobenzamide.
| Compound Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-cyano-2-fluorobenzamide |
|---|---|
| PubChem CID | 155482453 |
| Molecular Formula | C19H13FN4O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-4-cyano-2-fluorobenzamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)c2ccc(C#N)cc2F)ccc1N |
| InChI | InChI=1S/C19H13FN4O2/c20-16-7-11(9-21)1-3-14(16)19(25)24-13-2-4-17(22)15(8-13)18(23)12-5-6-26-10-12/h1-8,10,23H,22H2,(H,24,25)/b23-18+ |
| InChIKey | DWASUZROMCXXRL-PTGBLXJZSA-N |
| XLogP | 3.54 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|