C17H12N4O2S — CID 155574901
N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5-ethynyl-1,2-thiazole-3-carboxamide (PubChem CID 155574901) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5-ethynyl-1,2-thiazole-3-carboxamide.
| Compound Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5-ethynyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 155574901 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5-ethynyl-1,2-thiazole-3-carboxamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)c2cc(C#C)sn2)ccc1N |
| InChI | InChI=1S/C17H12N4O2S/c1-2-12-8-15(21-24-12)17(22)20-11-3-4-14(18)13(7-11)16(19)10-5-6-23-9-10/h1,3-9,19H,18H2,(H,20,22)/b19-16+ |
| InChIKey | ZBIRMMVNJBGYBQ-KNTRCKAVSA-N |
| XLogP | 2.97 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|