C19H19N5O2 — CID 155134676
N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide (PubChem CID 155134676) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 155134676 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[4-amino-3-(furan-3-carboximidoyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide |
| SMILES | [H]/N=C(\c1ccoc1)c1cc(NC(=O)C2CCc3cncn3C2)ccc1N |
| InChI | InChI=1S/C19H19N5O2/c20-17-4-2-14(7-16(17)18(21)13-5-6-26-10-13)23-19(25)12-1-3-15-8-22-11-24(15)9-12/h2,4-8,10-12,21H,1,3,9,20H2,(H,23,25)/b21-18+ |
| InChIKey | FQOLIZJWINSKAX-DYTRJAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|