C20H17F2N7O — CID 155698783
N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide (PubChem CID 155698783) has the molecular formula C20H17F2N7O and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide.
| Compound Name | N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 155698783 |
| Molecular Formula | C20H17F2N7O |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-amino-3-(pyrimidine-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
| SMILES | [H]/N=C(\c1ccncn1)c1cc(NC(=O)c2c(F)cc(NC)c(/C=N/[H])c2F)ccc1N |
| InChI | InChI=1S/C20H17F2N7O/c1-26-16-7-13(21)17(18(22)12(16)8-23)20(30)29-10-2-3-14(24)11(6-10)19(25)15-4-5-27-9-28-15/h2-9,23,25-26H,24H2,1H3,(H,29,30)/b23-8+,25-19- |
| InChIKey | WHTBELNGJIGCLX-ARZMVNDJSA-N |
| XLogP | 3.04 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|