C23H21F2N5O — CID 155134168
N-[4-amino-3-(2-methylbenzenecarboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide (PubChem CID 155134168) has the molecular formula C23H21F2N5O and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[4-amino-3-(2-methylbenzenecarboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide.
| Compound Name | N-[4-amino-3-(2-methylbenzenecarboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 155134168 |
| Molecular Formula | C23H21F2N5O |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[4-amino-3-(2-methylbenzenecarboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
| SMILES | [H]/N=C/c1c(NC)cc(F)c(C(=O)Nc2ccc(N)c(/C(=N/[H])c3ccccc3C)c2)c1F |
| InChI | InChI=1S/C23H21F2N5O/c1-12-5-3-4-6-14(12)22(28)15-9-13(7-8-18(15)27)30-23(31)20-17(24)10-19(29-2)16(11-26)21(20)25/h3-11,26,28-29H,27H2,1-2H3,(H,30,31)/b26-11+,28-22+ |
| InChIKey | QAJKFGWRLZBZHP-DXQNNDMSSA-N |
| XLogP | 4.56 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|