C20H22F2N6O — CID 155135059
N-[4-amino-3-(pyrrolidine-1-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide (PubChem CID 155135059) has the molecular formula C20H22F2N6O and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[4-amino-3-(pyrrolidine-1-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide.
| Compound Name | N-[4-amino-3-(pyrrolidine-1-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 155135059 |
| Molecular Formula | C20H22F2N6O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[4-amino-3-(pyrrolidine-1-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
| SMILES | [H]/N=C(/c1cc(NC(=O)c2c(F)cc(NC)c(/C=N/[H])c2F)ccc1N)N1CCCC1 |
| InChI | InChI=1S/C20H22F2N6O/c1-26-16-9-14(21)17(18(22)13(16)10-23)20(29)27-11-4-5-15(24)12(8-11)19(25)28-6-2-3-7-28/h4-5,8-10,23,25-26H,2-3,6-7,24H2,1H3,(H,27,29)/b23-10+,25-19- |
| InChIKey | RTSBXZPJUOJZDK-WIRMMCIHSA-N |
| XLogP | 3.26 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|