C18H16F4N2O — CID 87640477
2,3,6-trifluoro-N-(3-fluorophenyl)-5-methyl-4-pyrrolidin-1-ylbenzamide (PubChem CID 87640477) has the molecular formula C18H16F4N2O and a molecular weight of 352.33 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-(3-fluorophenyl)-5-methyl-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 2,3,6-trifluoro-N-(3-fluorophenyl)-5-methyl-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 87640477 |
| Molecular Formula | C18H16F4N2O |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2,3,6-trifluoro-N-(3-fluorophenyl)-5-methyl-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1c(F)c(C(=O)Nc2cccc(F)c2)c(F)c(F)c1N1CCCC1 |
| InChI | InChI=1S/C18H16F4N2O/c1-10-14(20)13(18(25)23-12-6-4-5-11(19)9-12)15(21)16(22)17(10)24-7-2-3-8-24/h4-6,9H,2-3,7-8H2,1H3,(H,23,25) |
| InChIKey | KZEXXZVXDIIIPW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|