C16H20N6 — CID 144697128
6-[2-amino-5-[(E)-1-(methylamino)prop-1-en-2-yl]benzenecarboximidoyl]-N-methylpyrimidin-4-amine (PubChem CID 144697128) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 6-[2-amino-5-[(E)-1-(methylamino)prop-1-en-2-yl]benzenecarboximidoyl]-N-methylpyrimidin-4-amine.
| Compound Name | 6-[2-amino-5-[(E)-1-(methylamino)prop-1-en-2-yl]benzenecarboximidoyl]-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 144697128 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 6-[2-amino-5-[(E)-1-(methylamino)prop-1-en-2-yl]benzenecarboximidoyl]-N-methylpyrimidin-4-amine |
| SMILES | [H]/N=C(\c1cc(NC)ncn1)c1cc(/C(C)=C/NC)ccc1N |
| InChI | InChI=1S/C16H20N6/c1-10(8-19-2)11-4-5-13(17)12(6-11)16(18)14-7-15(20-3)22-9-21-14/h4-9,18-19H,17H2,1-3H3,(H,20,21,22)/b10-8+,18-16- |
| InChIKey | DQTKPMVDVKKJCT-DXJSWHLASA-N |
| XLogP | 2.10 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|