C17H19N5 — CID 142208898
4-amino-3-(3-ethenylbenzenecarboximidoyl)-N'-(methylamino)benzenecarboximidamide (PubChem CID 142208898) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-amino-3-(3-ethenylbenzenecarboximidoyl)-N'-(methylamino)benzenecarboximidamide.
| Compound Name | 4-amino-3-(3-ethenylbenzenecarboximidoyl)-N'-(methylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142208898 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-amino-3-(3-ethenylbenzenecarboximidoyl)-N'-(methylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\c1cccc(C=C)c1)c1cc(/C(N)=N/NC)ccc1N |
| InChI | InChI=1S/C17H19N5/c1-3-11-5-4-6-12(9-11)16(19)14-10-13(7-8-15(14)18)17(20)22-21-2/h3-10,19,21H,1,18H2,2H3,(H2,20,22)/b19-16+ |
| InChIKey | BMRLFBXQTBOQBZ-KNTRCKAVSA-N |
| XLogP | 2.17 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|