C16H18N6 — CID 142958227
4-amino-N'-methanimidoyl-3-[3-(methylamino)benzenecarboximidoyl]benzenecarboximidamide (PubChem CID 142958227) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-amino-N'-methanimidoyl-3-[3-(methylamino)benzenecarboximidoyl]benzenecarboximidamide.
| Compound Name | 4-amino-N'-methanimidoyl-3-[3-(methylamino)benzenecarboximidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142958227 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-amino-N'-methanimidoyl-3-[3-(methylamino)benzenecarboximidoyl]benzenecarboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1ccc(N)c(/C(=N/[H])c2cccc(NC)c2)c1 |
| InChI | InChI=1S/C16H18N6/c1-21-12-4-2-3-10(7-12)15(19)13-8-11(5-6-14(13)18)16(20)22-9-17/h2-9,19,21H,18H2,1H3,(H3,17,20,22)/b19-15+ |
| InChIKey | YJSRKHPMLSJHRW-XDJHFCHBSA-N |
| XLogP | 2.04 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|