C18H22FN3O3 — CID 142179115
N-(2,3-dihydroxypropyl)formamide;2-(3-fluorobenzenecarboximidoyl)-4-methylaniline (PubChem CID 142179115) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)formamide;2-(3-fluorobenzenecarboximidoyl)-4-methylaniline.
| Compound Name | N-(2,3-dihydroxypropyl)formamide;2-(3-fluorobenzenecarboximidoyl)-4-methylaniline |
|---|---|
| PubChem CID | 142179115 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-(2,3-dihydroxypropyl)formamide;2-(3-fluorobenzenecarboximidoyl)-4-methylaniline |
| SMILES | O=CNCC(O)CO.[H]/N=C(\c1cccc(F)c1)c1cc(C)ccc1N |
| InChI | InChI=1S/C14H13FN2.C4H9NO3/c1-9-5-6-13(16)12(7-9)14(17)10-3-2-4-11(15)8-10;6-2-4(8)1-5-3-7/h2-8,17H,16H2,1H3;3-4,6,8H,1-2H2,(H,5,7)/b17-14+; |
| InChIKey | UROZJEHEUZJINJ-KLSJZZFUSA-N |
| XLogP | 1.22 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|