C13H12FN3 — CID 163940472
4-(3-fluorobenzenecarboximidoyl)benzene-1,3-diamine (PubChem CID 163940472) has the molecular formula C13H12FN3 and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-(3-fluorobenzenecarboximidoyl)benzene-1,3-diamine.
| Compound Name | 4-(3-fluorobenzenecarboximidoyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 163940472 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-(3-fluorobenzenecarboximidoyl)benzene-1,3-diamine |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1ccc(N)cc1N |
| InChI | InChI=1S/C13H12FN3/c14-9-3-1-2-8(6-9)13(17)11-5-4-10(15)7-12(11)16/h1-7,17H,15-16H2/b17-13+ |
| InChIKey | RQOLSHKOCWYQKM-GHRIWEEISA-N |
| XLogP | 2.41 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|