C14H13FN3OTl — CID 142179068
[4-amino-2-(3-fluorobenzenecarboximidoyl)-3-methoxyanilino]thallium (PubChem CID 142179068) has the molecular formula C14H13FN3OTl and a molecular weight of 462.66 g/mol. Its IUPAC name is [4-amino-2-(3-fluorobenzenecarboximidoyl)-3-methoxyanilino]thallium.
| Compound Name | [4-amino-2-(3-fluorobenzenecarboximidoyl)-3-methoxyanilino]thallium |
|---|---|
| PubChem CID | 142179068 |
| Molecular Formula | C14H13FN3OTl |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [4-amino-2-(3-fluorobenzenecarboximidoyl)-3-methoxyanilino]thallium |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1c(N[Tl])ccc(N)c1OC |
| InChI | InChI=1S/C14H13FN3O.Tl/c1-19-14-11(17)6-5-10(16)12(14)13(18)8-3-2-4-9(15)7-8;/h2-7,16,18H,17H2,1H3;/q-1;+1/b18-13+; |
| InChIKey | XZVPVOCXWZUQJB-PUBYZPQMSA-N |
| XLogP | 2.33 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|