C23H22FN3O3 — CID 142178954
N-[[4-amino-3-(3-fluorobenzenecarboximidoyl)-2-methoxyphenyl]methyl]-3-methoxybenzamide (PubChem CID 142178954) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[[4-amino-3-(3-fluorobenzenecarboximidoyl)-2-methoxyphenyl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[4-amino-3-(3-fluorobenzenecarboximidoyl)-2-methoxyphenyl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 142178954 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[[4-amino-3-(3-fluorobenzenecarboximidoyl)-2-methoxyphenyl]methyl]-3-methoxybenzamide |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1c(N)ccc(CNC(=O)c2cccc(OC)c2)c1OC |
| InChI | InChI=1S/C23H22FN3O3/c1-29-18-8-4-6-15(12-18)23(28)27-13-16-9-10-19(25)20(22(16)30-2)21(26)14-5-3-7-17(24)11-14/h3-12,26H,13,25H2,1-2H3,(H,27,28)/b26-21+ |
| InChIKey | RWUJTLRYWCJVKE-YYADALCUSA-N |
| XLogP | 3.77 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|