C15H16FN3 — CID 142178906
2-(3-fluorobenzenecarboximidoyl)-4-(methylaminomethyl)aniline (PubChem CID 142178906) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(3-fluorobenzenecarboximidoyl)-4-(methylaminomethyl)aniline.
| Compound Name | 2-(3-fluorobenzenecarboximidoyl)-4-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 142178906 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(3-fluorobenzenecarboximidoyl)-4-(methylaminomethyl)aniline |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1cc(CNC)ccc1N |
| InChI | InChI=1S/C15H16FN3/c1-19-9-10-5-6-14(17)13(7-10)15(18)11-3-2-4-12(16)8-11/h2-8,18-19H,9,17H2,1H3/b18-15+ |
| InChIKey | WBNJVFBPHASGRI-OBGWFSINSA-N |
| XLogP | 2.54 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|