C18H21FN3O2+ — CID 142179020
[[2-amino-5-[[(2S)-1-hydroxybutan-2-yl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium (PubChem CID 142179020) has the molecular formula C18H21FN3O2+ and a molecular weight of 330.38 g/mol. Its IUPAC name is [[2-amino-5-[[(2S)-1-hydroxybutan-2-yl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium.
| Compound Name | [[2-amino-5-[[(2S)-1-hydroxybutan-2-yl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 142179020 |
| Molecular Formula | C18H21FN3O2+ |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [[2-amino-5-[[(2S)-1-hydroxybutan-2-yl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium |
| SMILES | CC[C@@H](CO)NC(=O)c1ccc(N)c(C(=[NH2+])c2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H20FN3O2/c1-2-14(10-23)22-18(24)12-6-7-16(20)15(9-12)17(21)11-4-3-5-13(19)8-11/h3-9,14,21,23H,2,10,20H2,1H3,(H,22,24)/p+1/t14-/m0/s1 |
| InChIKey | VLWGRUYAIASCFH-AWEZNQCLSA-O |
| XLogP | 0.51 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|