C22H20ClFN3O2+ — CID 142179025
[[2-amino-5-[[1-(4-chlorophenyl)-2-hydroxyethyl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium (PubChem CID 142179025) has the molecular formula C22H20ClFN3O2+ and a molecular weight of 412.87 g/mol. Its IUPAC name is [[2-amino-5-[[1-(4-chlorophenyl)-2-hydroxyethyl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium.
| Compound Name | [[2-amino-5-[[1-(4-chlorophenyl)-2-hydroxyethyl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 142179025 |
| Molecular Formula | C22H20ClFN3O2+ |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [[2-amino-5-[[1-(4-chlorophenyl)-2-hydroxyethyl]carbamoyl]phenyl]-(3-fluorophenyl)methylidene]azanium |
| SMILES | Nc1ccc(C(=O)NC(CO)c2ccc(Cl)cc2)cc1C(=[NH2+])c1cccc(F)c1 |
| InChI | InChI=1S/C22H19ClFN3O2/c23-16-7-4-13(5-8-16)20(12-28)27-22(29)15-6-9-19(25)18(11-15)21(26)14-2-1-3-17(24)10-14/h1-11,20,26,28H,12,25H2,(H,27,29)/p+1 |
| InChIKey | KBSSPJCEGPSJBZ-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|