C20H23F2N5O2 — CID 155698798
N-[4-amino-3-(oxolane-3-carboximidoyl)phenyl]-4,6-difluoro-1-methylindazole-5-carboxamide;molecular hydrogen (PubChem CID 155698798) has the molecular formula C20H23F2N5O2 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[4-amino-3-(oxolane-3-carboximidoyl)phenyl]-4,6-difluoro-1-methylindazole-5-carboxamide;molecular hydrogen.
| Compound Name | N-[4-amino-3-(oxolane-3-carboximidoyl)phenyl]-4,6-difluoro-1-methylindazole-5-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 155698798 |
| Molecular Formula | C20H23F2N5O2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[4-amino-3-(oxolane-3-carboximidoyl)phenyl]-4,6-difluoro-1-methylindazole-5-carboxamide;molecular hydrogen |
| SMILES | [H]/N=C(/c1cc(NC(=O)c2c(F)cc3c(cnn3C)c2F)ccc1N)C1CCOC1.[H][H].[H][H] |
| InChI | InChI=1S/C20H19F2N5O2.2H2/c1-27-16-7-14(21)17(18(22)13(16)8-25-27)20(28)26-11-2-3-15(23)12(6-11)19(24)10-4-5-29-9-10;;/h2-3,6-8,10,24H,4-5,9,23H2,1H3,(H,26,28);2*1H/b24-19+;; |
| InChIKey | BNVJODWXFYLFJS-YCQUHOTGSA-N |
| XLogP | 3.58 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|