C20H17N7O+2 — CID 176517175
[[2-amino-5-[(5-cyano-3,4-dimethylpyridin-1-ium-2-carbonyl)amino]phenyl]-pyrimidin-4-ylmethylidene]azanium (PubChem CID 176517175) has the molecular formula C20H17N7O+2 and a molecular weight of 371.40 g/mol. Its IUPAC name is [[2-amino-5-[(5-cyano-3,4-dimethylpyridin-1-ium-2-carbonyl)amino]phenyl]-pyrimidin-4-ylmethylidene]azanium.
| Compound Name | [[2-amino-5-[(5-cyano-3,4-dimethylpyridin-1-ium-2-carbonyl)amino]phenyl]-pyrimidin-4-ylmethylidene]azanium |
|---|---|
| PubChem CID | 176517175 |
| Molecular Formula | C20H17N7O+2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [[2-amino-5-[(5-cyano-3,4-dimethylpyridin-1-ium-2-carbonyl)amino]phenyl]-pyrimidin-4-ylmethylidene]azanium |
| SMILES | CC1=C(C)C(C(=O)Nc2ccc(N)c(C(=[NH2+])c3ccncn3)c2)=[N+]=C=C1C#N |
| InChI | InChI=1S/C20H15N7O/c1-11-12(2)19(25-9-13(11)8-21)20(28)27-14-3-4-16(22)15(7-14)18(23)17-5-6-24-10-26-17/h3-7,10,22-23,28H,1-2H3/p+2 |
| InChIKey | UYRYDVPWNUZHHI-UHFFFAOYSA-P |
| XLogP | -0.43 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|