C22H25ClFN3O5Si — CID 59304979
methyl 2-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-fluoro-4-nitrophenyl)acetate (PubChem CID 59304979) has the molecular formula C22H25ClFN3O5Si and a molecular weight of 494.00 g/mol. Its IUPAC name is methyl 2-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-fluoro-4-nitrophenyl)acetate.
| Compound Name | methyl 2-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-fluoro-4-nitrophenyl)acetate |
|---|---|
| PubChem CID | 59304979 |
| Molecular Formula | C22H25ClFN3O5Si |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | methyl 2-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-fluoro-4-nitrophenyl)acetate |
| SMILES | COC(=O)C(c1ccc([N+](=O)[O-])cc1F)c1cc(Cl)nc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H25ClFN3O5Si/c1-31-22(28)20(16-6-5-14(27(29)30)11-18(16)24)17-12-19(23)25-21-15(17)7-8-26(21)13-32-9-10-33(2,3)4/h5-8,11-12,20H,9-10,13H2,1-4H3 |
| InChIKey | OIMQLPSLUPOGFY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|