C19H28F3N3O2Si — CID 175873640
4,4,4-trifluoro-N-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]butanamide (PubChem CID 175873640) has the molecular formula C19H28F3N3O2Si and a molecular weight of 415.53 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 175873640 |
| Molecular Formula | C19H28F3N3O2Si |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]butanamide |
| SMILES | CC(NC(=O)CCC(F)(F)F)c1ccc2c(c1)ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H28F3N3O2Si/c1-14(24-18(26)7-8-19(20,21)22)15-5-6-17-16(11-15)23-12-25(17)13-27-9-10-28(2,3)4/h5-6,11-12,14H,7-10,13H2,1-4H3,(H,24,26) |
| InChIKey | ZSEXACWPBOPMLW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|