C27H33F4N3O4Si — CID 168817646
methyl 2-[[4-(3,3-difluoropropoxy)-2,6-difluorophenyl]-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]amino]methyl]prop-2-enoate (PubChem CID 168817646) has the molecular formula C27H33F4N3O4Si and a molecular weight of 567.66 g/mol. Its IUPAC name is methyl 2-[[4-(3,3-difluoropropoxy)-2,6-difluorophenyl]-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]amino]methyl]prop-2-enoate.
| Compound Name | methyl 2-[[4-(3,3-difluoropropoxy)-2,6-difluorophenyl]-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 168817646 |
| Molecular Formula | C27H33F4N3O4Si |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | methyl 2-[[4-(3,3-difluoropropoxy)-2,6-difluorophenyl]-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]amino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(Nc1ccc2c(c1)ncn2COCC[Si](C)(C)C)c1c(F)cc(OCCC(F)F)cc1F |
| InChI | InChI=1S/C27H33F4N3O4Si/c1-17(27(35)36-2)26(25-20(28)13-19(14-21(25)29)38-9-8-24(30)31)33-18-6-7-23-22(12-18)32-15-34(23)16-37-10-11-39(3,4)5/h6-7,12-15,24,26,33H,1,8-11,16H2,2-5H3 |
| InChIKey | JUDWLJLEEKCBKK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|