C25H28BrF2N3O2Si — CID 168817649
4-(4-bromo-2,6-difluorophenyl)-3-cyclopropyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one (PubChem CID 168817649) has the molecular formula C25H28BrF2N3O2Si and a molecular weight of 548.50 g/mol. Its IUPAC name is 4-(4-bromo-2,6-difluorophenyl)-3-cyclopropyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one.
| Compound Name | 4-(4-bromo-2,6-difluorophenyl)-3-cyclopropyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
|---|---|
| PubChem CID | 168817649 |
| Molecular Formula | C25H28BrF2N3O2Si |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 4-(4-bromo-2,6-difluorophenyl)-3-cyclopropyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(N3C(=O)C(C4CC4)C3c3c(F)cc(Br)cc3F)ccc21 |
| InChI | InChI=1S/C25H28BrF2N3O2Si/c1-34(2,3)9-8-33-14-30-13-29-20-12-17(6-7-21(20)30)31-24(22(25(31)32)15-4-5-15)23-18(27)10-16(26)11-19(23)28/h6-7,10-13,15,22,24H,4-5,8-9,14H2,1-3H3 |
| InChIKey | ZEFSIFLCUYEDGW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|