C26H30IN5O2Si — CID 167407704
4-(4-iodophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one (PubChem CID 167407704) has the molecular formula C26H30IN5O2Si and a molecular weight of 599.55 g/mol. Its IUPAC name is 4-(4-iodophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(4-iodophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 167407704 |
| Molecular Formula | C26H30IN5O2Si |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | 4-(4-iodophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1nn(C)c2c1C(c1ccc(I)cc1)N(c1ccc3c(c1)ncn3COCC[Si](C)(C)C)C2=O |
| InChI | InChI=1S/C26H30IN5O2Si/c1-17-23-24(18-6-8-19(27)9-7-18)32(26(33)25(23)30(2)29-17)20-10-11-22-21(14-20)28-15-31(22)16-34-12-13-35(3,4)5/h6-11,14-15,24H,12-13,16H2,1-5H3 |
| InChIKey | RGJLGFUYZFRGSP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|