C26H29BrFN5O2Si — CID 167407685
4-(4-bromo-2-fluorophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one (PubChem CID 167407685) has the molecular formula C26H29BrFN5O2Si and a molecular weight of 570.54 g/mol. Its IUPAC name is 4-(4-bromo-2-fluorophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(4-bromo-2-fluorophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 167407685 |
| Molecular Formula | C26H29BrFN5O2Si |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 4-(4-bromo-2-fluorophenyl)-1,3-dimethyl-5-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]-4H-pyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1nn(C)c2c1C(c1ccc(Br)cc1F)N(c1ccc3c(c1)ncn3COCC[Si](C)(C)C)C2=O |
| InChI | InChI=1S/C26H29BrFN5O2Si/c1-16-23-24(19-8-6-17(27)12-20(19)28)33(26(34)25(23)31(2)30-16)18-7-9-22-21(13-18)29-14-32(22)15-35-10-11-36(3,4)5/h6-9,12-14,24H,10-11,15H2,1-5H3 |
| InChIKey | BQBBSZLXVJMGCO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|