C26H31N3O4Si — CID 175565972
2-[2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 175565972) has the molecular formula C26H31N3O4Si and a molecular weight of 477.64 g/mol. Its IUPAC name is 2-[2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175565972 |
| Molecular Formula | C26H31N3O4Si |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(C(COC3CC3)N3C(=O)c4ccccc4C3=O)ccc21 |
| InChI | InChI=1S/C26H31N3O4Si/c1-34(2,3)13-12-32-17-28-16-27-22-14-18(8-11-23(22)28)24(15-33-19-9-10-19)29-25(30)20-6-4-5-7-21(20)26(29)31/h4-8,11,14,16,19,24H,9-10,12-13,15,17H2,1-3H3 |
| InChIKey | PCVZLKRCMZPUPY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|