C27H39N3O3SSi — CID 172509132
3-[(1S)-2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]-2,4,6-trimethylbenzenesulfinamide (PubChem CID 172509132) has the molecular formula C27H39N3O3SSi and a molecular weight of 513.78 g/mol. Its IUPAC name is 3-[(1S)-2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]-2,4,6-trimethylbenzenesulfinamide.
| Compound Name | 3-[(1S)-2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]-2,4,6-trimethylbenzenesulfinamide |
|---|---|
| PubChem CID | 172509132 |
| Molecular Formula | C27H39N3O3SSi |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 3-[(1S)-2-cyclopropyloxy-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl]-2,4,6-trimethylbenzenesulfinamide |
| SMILES | Cc1cc(C)c(S(N)=O)c(C)c1[C@@H](COC1CC1)c1ccc2c(c1)ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H39N3O3SSi/c1-18-13-19(2)27(34(28)31)20(3)26(18)23(15-33-22-8-9-22)21-7-10-25-24(14-21)29-16-30(25)17-32-11-12-35(4,5)6/h7,10,13-14,16,22-23H,8-9,11-12,15,17,28H2,1-6H3/t23-,34?/m0/s1 |
| InChIKey | GCJJMDUDRZHXDG-SKBWGGTPSA-N |
| XLogP | 5.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|