C33H43F5N4O3Si — CID 172509330
2-[(S)-(4,4-difluorocyclohexyl)-[5-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]benzamide (PubChem CID 172509330) has the molecular formula C33H43F5N4O3Si and a molecular weight of 666.81 g/mol. Its IUPAC name is 2-[(S)-(4,4-difluorocyclohexyl)-[5-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-[(S)-(4,4-difluorocyclohexyl)-[5-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 172509330 |
| Molecular Formula | C33H43F5N4O3Si |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | 2-[(S)-(4,4-difluorocyclohexyl)-[5-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]benzamide |
| SMILES | C[C@@H](NC(=O)CCC(F)(F)F)c1ccc2c(c1)nc([C@H](c1ccccc1C(N)=O)C1CCC(F)(F)CC1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C33H43F5N4O3Si/c1-21(40-28(43)13-16-33(36,37)38)23-9-10-27-26(19-23)41-31(42(27)20-45-17-18-46(2,3)4)29(22-11-14-32(34,35)15-12-22)24-7-5-6-8-25(24)30(39)44/h5-10,19,21-22,29H,11-18,20H2,1-4H3,(H2,39,44)(H,40,43)/t21-,29+/m1/s1 |
| InChIKey | LVWKQXTXXSTYQF-PBBNMVCDSA-N |
| XLogP | 7.92 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|