C18H29N3O2SSi — CID 175566246
tert-butyl-oxido-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methylideneamino]sulfanium (PubChem CID 175566246) has the molecular formula C18H29N3O2SSi and a molecular weight of 379.60 g/mol. Its IUPAC name is tert-butyl-oxido-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methylideneamino]sulfanium.
| Compound Name | tert-butyl-oxido-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methylideneamino]sulfanium |
|---|---|
| PubChem CID | 175566246 |
| Molecular Formula | C18H29N3O2SSi |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl-oxido-[[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]methylideneamino]sulfanium |
| SMILES | CC(C)(C)[S+]([O-])N=Cc1ccc2c(c1)ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H29N3O2SSi/c1-18(2,3)24(22)20-12-15-7-8-17-16(11-15)19-13-21(17)14-23-9-10-25(4,5)6/h7-8,11-13H,9-10,14H2,1-6H3 |
| InChIKey | XGCMJDUUMIFXDI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|